CymitQuimica logo

CAS 787564-07-2

:

benzyl 4,7-diazaspiro[2.5]octane-4-carboxylate

Description:
Benzyl 4,7-diazaspiro[2.5]octane-4-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework containing nitrogen atoms. This compound typically exhibits properties associated with both amines and carboxylic esters due to the presence of the diaza group and the carboxylate moiety. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its structural complexity and the presence of functional groups that can participate in various chemical reactions. The benzyl group contributes to its lipophilicity, which may enhance its ability to cross biological membranes. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest for further research. Its synthesis and characterization would involve standard organic chemistry techniques, and safety precautions should be taken when handling this compound, as with any chemical substance.
Formula:C14H18N2O2
InChI:InChI=1/C14H18N2O2/c17-13(18-10-12-4-2-1-3-5-12)16-9-8-15-11-14(16)6-7-14/h1-5,15H,6-11H2
SMILES:c1ccc(cc1)COC(=O)N1CCNCC21CC2
Synonyms:
  • 4,7-Diazaspiro[2.5]Octane-4-Carboxylate De Benzyle
  • Benzyl-4,7-diazaspiro[2.5]octan-4-carboxylat
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.