CymitQuimica logo

CAS 787580-87-4

:

4-chloro-1,2-dihydroindazol-3-one

Description:
4-Chloro-1,2-dihydroindazol-3-one is a chemical compound characterized by its indazole structure, which features a fused five-membered ring containing nitrogen atoms. The presence of a chlorine atom at the 4-position contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure includes a carbonyl group, which can participate in hydrogen bonding and influence its interactions with other molecules. The compound may be of interest in medicinal chemistry due to its potential biological activities, including antimicrobial or anticancer properties, although specific biological data would need to be referenced for detailed insights. As with many nitrogen-containing heterocycles, it may also serve as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C7H5ClN2O
InChI:InChI=1/C7H5ClN2O/c8-4-2-1-3-5-6(4)7(11)10-9-5/h1-3H,(H2,9,10,11)
SMILES:c1cc(c2c(c1)[nH]nc2O)Cl
Synonyms:
  • 3H-indazol-3-one, 4-chloro-1,2-dihydro-
  • 4-Chloro-1,2-dihydro-3H-Indazol-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.