CAS 787580-91-0
:1,2-Dihydro-5-hydroxy-3H-indazol-3-one
Description:
1,2-Dihydro-5-hydroxy-3H-indazol-3-one, with the CAS number 787580-91-0, is a chemical compound characterized by its indazole core structure, which features a fused five-membered ring containing nitrogen atoms. This compound typically exhibits properties such as being a solid at room temperature and may have moderate solubility in polar solvents due to the presence of the hydroxyl group. The hydroxyl group contributes to its potential reactivity, allowing for hydrogen bonding and influencing its interaction with biological systems. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. As with many indazole derivatives, the specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is studied. Overall, 1,2-Dihydro-5-hydroxy-3H-indazol-3-one represents a unique structure with potential implications in various chemical and biological contexts.
Formula:C7H6N2O2
InChI:InChI=1S/C7H6N2O2/c10-4-1-2-6-5(3-4)7(11)9-8-6/h1-3,10H,(H2,8,9,11)
InChI key:InChIKey=IWAVRNMDRLJANM-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(O)C2)NN1
Synonyms:- 3,5-DIHYDROXY (1H)INDAZOLE
- 1H-Indazole-3,5-diol
- 2H-Indazole-3,5-diol
- 3,5-Dihydroxy (1H)indazole
- 3H-Indazol-3-one, 1,2-dihydro-5-hydroxy-
- 3,5-DIHYDROXYINDAZOLE
- 1,2-Dihydro-5-hydroxy-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
