CymitQuimica logo

CAS 787596-41-2

:

4-pyridinecarboxylic acid, 2-chloro-3-methyl-, methyl ester

Description:
4-Pyridinecarboxylic acid, 2-chloro-3-methyl-, methyl ester, also known by its CAS number 787596-41-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. The presence of a chlorine atom at the 2-position and a methyl group at the 3-position of the pyridine ring contributes to its unique reactivity and properties. Typically, such compounds exhibit moderate polarity due to the ester and carboxylic acid functionalities, which can influence their solubility in various solvents. They may also participate in hydrogen bonding and exhibit potential biological activity, making them of interest in pharmaceutical and agrochemical research. The compound's stability, reactivity, and potential applications can vary based on the specific substituents and their positions on the pyridine ring.
Formula:C8H8ClNO2
InChI:InChI=1/C8H8ClNO2/c1-5-6(8(11)12-2)3-4-10-7(5)9/h3-4H,1-2H3
InChI key:LUWGTKBLQCPEMS-UHFFFAOYSA-N
SMILES:Cc1c(ccnc1Cl)C(=O)OC
Synonyms:
  • Methyl 2-chloro-3-methylisonicotinate
Found 5 products.