CAS 78761-61-2
:L-tyrosylglycylglycyl-L-phenylalanyl-L-methionyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
Description:
L-tyrosylglycylglycyl-L-phenylalanyl-L-methionyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide, with CAS number 78761-61-2, is a synthetic peptide that exhibits characteristics typical of peptide compounds. This substance is composed of multiple amino acids, including tyrosine, glycine, phenylalanine, methionine, and ornithine, which contribute to its structural complexity and potential biological activity. Peptides like this one often play roles in various biological processes, including signaling and regulation within cells. The presence of specific functional groups, such as the diaminomethylidene moiety, suggests potential reactivity and interactions with biological targets. Additionally, the peptide's hydrophilicity or hydrophobicity can influence its solubility and stability in different environments, which is crucial for its application in biochemical research or therapeutic contexts. Overall, this compound's unique structure may offer insights into its function and potential uses in pharmacology or biochemistry.
Formula:C42H57N11O8S
InChI:InChI=1/C42H57N11O8S/c1-62-20-18-32(40(60)51-31(13-8-19-47-42(45)46)39(59)53-33(37(44)57)22-26-9-4-2-5-10-26)52-41(61)34(23-27-11-6-3-7-12-27)50-36(56)25-48-35(55)24-49-38(58)30(43)21-28-14-16-29(54)17-15-28/h2-7,9-12,14-17,30-34,54H,8,13,18-25,43H2,1H3,(H2,44,57)(H,48,55)(H,49,58)(H,50,56)(H,51,60)(H,52,61)(H,53,59)(H4,45,46,47)/t30-,31-,32-,33-,34-/m0/s1
SMILES:CSCC[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1ccccc1)C(=N)O)O)O)N=C([C@H](Cc1ccccc1)N=C(CN=C(CN=C([C@H](Cc1ccc(cc1)O)N)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Met-Enkephalin-Arg-Phe amide
CAS:<p>Met-Enkephalin-Arg-Phe amide H-Tyr-Gly-Gly-Phe-Met-Arg-Phe is a subunit of the endogenous opioid peptide Met-enkephalin. It is a proteolytic cleavage product of proenkephalin A and is also known as Tyr2, Phe2, or Arg6. Met-enkephalin has been shown to participate in signal transduction pathways that regulate blood pressure and exocrine secretion. Metenkephalin is an amide containing two cysteine residues with a hydrophobic side chain, which can bind metal ions such as calcium ions. Metenkephalin binds to the membrane of cells, altering membrane potential and naloxone binding sites.<br>Met enkephalin has been shown to be involved in serotonin release from platelets and inhibition of serotonin uptake by platelets.</p>Formula:C42H57N11O8SPurity:Min. 95%Molecular weight:876.04 g/mol
