CAS 78761-79-2

N-[2-(dimethylnitroryl)ethyl]-N-(thiophen-2-ylmethyl)pyridin-2-amine

Description:

N-[2-(dimethylnitroyl)ethyl]-N-(thiophen-2-ylmethyl)pyridin-2-amine, with the CAS number 78761-79-2, is a chemical compound that features a pyridine ring, a thiophene moiety, and a dimethylnitroyl group. This compound is characterized by its complex structure, which includes multiple functional groups that can influence its reactivity and biological activity. The presence of the nitro group suggests potential for electrophilic behavior, while the pyridine and thiophene rings may contribute to its aromatic properties and potential interactions with biological targets. The compound's solubility, stability, and reactivity can vary based on the specific conditions, such as pH and solvent. Additionally, its potential applications could span across medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine group, which is often involved in forming hydrogen bonds and interacting with biological macromolecules. Overall, this compound's unique structural features make it a subject of interest in various chemical and biological research fields.

Formula: C₁₄H₁₉N₃OS

InChI: InChI=1/C14H19N3OS/c1-17(2,18)10-9-16(12-13-6-5-11-19-13)14-7-3-4-8-15-14/h3-8,11H,9-10,12H2,1-2H3

SMILES: CN(=O)(C)CCN(Cc1cccs1)c1ccccn1

Methapyrilene N-Oxide

CAS: 78761-79-2

Color and Shape: Neat

Ref: 86-MM1680.01