CAS 787615-14-9

γ-Amino-4-bromobenzenepropanol

Description:

γ-Amino-4-bromobenzenepropanol, identified by its CAS number 787615-14-9, is an organic compound characterized by the presence of an amino group and a bromobenzene moiety. This compound features a propanol chain, which contributes to its alcohol functionality. The amino group (-NH2) typically imparts basic properties, allowing for potential interactions in biological systems, while the bromine atom introduces halogen characteristics that can influence reactivity and solubility. The presence of the aromatic bromobenzene structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety and handling considerations are essential due to the presence of bromine, which can be hazardous. Overall, γ-Amino-4-bromobenzenepropanol is a compound with diverse potential applications, particularly in the fields of chemistry and pharmacology.

Formula: C₉H₁₂BrNO

InChI: InChI=1S/C9H12BrNO/c10-8-3-1-7(2-4-8)9(11)5-6-12/h1-4,9,12H,5-6,11H2

InChI key: InChIKey=XWXQMFXVRNFZOH-UHFFFAOYSA-N

SMILES: C(CCO)(N)C1=CC=C(Br)C=C1

Synonyms:

• γ-Amino-4-bromobenzenepropanol
• Benzenepropanol, γ-amino-4-bromo-
• 3-Amino-3-(4-bromophenyl)propan-1-ol

3-(4-Bromophenyl)-dl-β-alaninol hcl

CAS: 787615-14-9

Formula: C₉H₁₂BrNO

Purity: 95%

Molecular weight: 230.1017

Ref: IN-DA00G2X8

3-Amino-3-(4-bromo-phenyl)-propan-1-ol

CAS: 787615-14-9

Versatile small molecule scaffold

Formula: C₉H₁₂BrNO

Purity: Min. 95%

Molecular weight: 230.1 g/mol

Ref: 3D-MGB61514