
CAS 787615-15-0
:γ-Amino-3-methyl-2-thiophenepropanol
Description:
γ-Amino-3-methyl-2-thiophenepropanol, identified by its CAS number 787615-15-0, is an organic compound characterized by the presence of an amino group, a thiophene ring, and a propanol side chain. This compound features a thiophene moiety, which contributes to its aromatic properties and potential reactivity. The amino group (-NH2) is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis. The presence of the methyl group enhances its steric properties and may influence its solubility and reactivity. Additionally, the alcohol functional group (-OH) in the propanol chain can engage in hydrogen bonding, affecting the compound's physical properties such as boiling point and solubility in polar solvents. Overall, γ-Amino-3-methyl-2-thiophenepropanol may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its unique structural features and functional groups.
Formula:C8H13NOS
InChI:InChI=1S/C8H13NOS/c1-6-3-5-11-8(6)7(9)2-4-10/h3,5,7,10H,2,4,9H2,1H3
InChI key:InChIKey=WIRLDGKQEBXDOF-UHFFFAOYSA-N
SMILES:C(CCO)(N)C1=C(C)C=CS1
Synonyms:- 2-Thiophenepropanol, γ-amino-3-methyl-
- γ-Amino-3-methyl-2-thiophenepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.