CAS 787615-23-0

3-amino-3-(2,4-dichlorophenyl)propan-1-ol

Description:

3-amino-3-(2,4-dichlorophenyl)propan-1-ol is an organic compound characterized by the presence of an amino group, a hydroxyl group, and a dichlorophenyl moiety. This compound features a propanol backbone, where the amino group is attached to the third carbon, and a 2,4-dichlorophenyl group is substituted at the same carbon. The presence of the amino group imparts basic properties, while the hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing solubility in polar solvents. The dichlorophenyl substituent introduces significant steric and electronic effects, which can influence the compound's reactivity and biological activity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with the chlorinated aromatic ring.

Formula: C₉H₁₁Cl₂NO

InChI: InChI=1/C9H11Cl2NO/c10-6-1-2-7(8(11)5-6)9(12)3-4-13/h1-2,5,9,13H,3-4,12H2

SMILES: c1cc(c(cc1Cl)Cl)C(CCO)N

Synonyms:

• Benzenepropanol, Γ-Amino-2,4-Dichloro-
• 3-Amino-3-(2,4-dichlorophenyl)propan-1-ol

3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol

CAS: 787615-23-0

3-Amino-3-(2,4-dichloro-phenyl)-propan-1-ol

Purity: ≥95%

Color and Shape: White Powder

Molecular weight: 220.10g/mol

Ref: 54-OR307627