CAS 787615-40-1

γ-Amino-2-chloro-6-fluorobenzenepropanol

Description:

γ-Amino-2-chloro-6-fluorobenzenepropanol, identified by its CAS number 787615-40-1, is a chemical compound characterized by its unique structural features, which include an amino group, a chloro substituent, and a fluorine atom attached to a benzene ring. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group. The presence of the chlorine and fluorine atoms can influence its reactivity and biological activity, potentially enhancing its lipophilicity and altering its interaction with biological systems. The amino group may impart basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals, although detailed studies would be necessary to fully understand its behavior and potential uses in various fields.

Formula: C₉H₁₁ClFNO

InChI: InChI=1S/C9H11ClFNO/c10-6-2-1-3-7(11)9(6)8(12)4-5-13/h1-3,8,13H,4-5,12H2

InChI key: InChIKey=ZFOTYJZQQJZTLY-UHFFFAOYSA-N

SMILES: C(CCO)(N)C1=C(Cl)C=CC=C1F

Synonyms:

• γ-Amino-2-chloro-6-fluorobenzenepropanol
• Benzenepropanol, γ-amino-2-chloro-6-fluoro-