CAS 78771-28-5
:2-methyl-3,5-dinitrothiophene
Description:
2-Methyl-3,5-dinitrothiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of two nitro groups at the 3 and 5 positions, along with a methyl group at the 2 position, contributes to its unique chemical properties. This compound is typically yellow to orange in color and is known for its potential applications in organic synthesis and as a precursor in the development of various chemical products. It exhibits moderate solubility in organic solvents, which is common for nitro-substituted aromatic compounds. The nitro groups enhance its reactivity, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the presence of the thiophene ring can impart interesting electronic properties, making it of interest in materials science and organic electronics. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.
Formula:C5H4N2O4S
InChI:InChI=1/C5H4N2O4S/c1-3-4(6(8)9)2-5(12-3)7(10)11/h2H,1H3
SMILES:Cc1c(cc(N(=O)=O)s1)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-methyl-3,5-dinitrothiophene
CAS:2-methyl-3,5-dinitrothiophene is an organic solvent with a nonlinear optical response. It has been used as a monomer for the preparation of polymers. 2-Methyl-3,5-dinitrothiophene has shown thermal stability and hydroxy groups that can be used to solvate other molecules. This compound is also soluble in organic solvents such as acetone and chloroform. The chromophore present in 2-methyl-3,5-dinitrothiophene gives it a yellow color at low concentrations and a reddish color at high concentrations.Formula:C5H4N2O4SPurity:Min. 95%Molecular weight:188.16 g/mol
