CymitQuimica logo

CAS 78782-15-7

:

Dammarane-3,12,25-triol, 20,24-epoxy-, 12-acetate 3-(hydrogen propanedioate), (3α,12β,24R)-

Description:
Dammarane-3,12,25-triol, 20,24-epoxy-, 12-acetate 3-(hydrogen propanedioate), (3α,12β,24R)- is a complex triterpenoid compound derived from the dammarane family, which is characterized by a tetracyclic structure. This substance features multiple functional groups, including hydroxyl (-OH) groups, an epoxy group, and an acetate moiety, contributing to its chemical reactivity and potential biological activity. The presence of the epoxy group suggests that it may participate in various chemical reactions, such as nucleophilic attacks or rearrangements. The compound's stereochemistry, indicated by the (3α,12β,24R) configuration, plays a crucial role in determining its biological interactions and properties. Dammarane derivatives are often studied for their pharmacological potential, including anti-inflammatory and anticancer activities. The CAS number 78782-15-7 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. Overall, the structural complexity and functional diversity of this triterpenoid make it a subject of interest in both organic chemistry and medicinal research.
Formula:C35H56O8
InChI:InChI=1S/C35H56O8/c1-20(36)41-22-18-24-32(6)14-12-25(42-28(39)19-27(37)38)30(2,3)23(32)11-16-33(24,7)34(8)15-10-21(29(22)34)35(9)17-13-26(43-35)31(4,5)40/h21-26,29,40H,10-19H2,1-9H3,(H,37,38)/t21-,22+,23-,24+,25+,26+,29-,32-,33+,34+,35-/m0/s1
InChI key:InChIKey=RLVAVWQAAQFUOP-GNYBQDBLSA-N
SMILES:C[C@]12[C@@]([C@](CC1)([C@@]3(C)O[C@@H](C(C)(C)O)CC3)[H])([C@H](OC(C)=O)C[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)CC[C@@H](OC(CC(O)=O)=O)C5(C)C)[H])[H])[H]
Synonyms:
  • Dammarane-3,12,25-triol, 20,24-epoxy-, 12-acetate 3-(hydrogen propanedioate), (3α,12β,24R)-
  • Papyriferic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.