CAS 78782-47-5

N-[(2Z)-1-methylpyrrolidin-2-ylidene]-N'-phenylmorpholine-4-carboximidamide (2E)-but-2-enedioate (1:1)

Description:

N-[(2Z)-1-methylpyrrolidin-2-ylidene]-N'-phenylmorpholine-4-carboximidamide (2E)-but-2-enedioate (1:1), with CAS number 78782-47-5, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a morpholine moiety, and a carboximidamide functional group. This compound features a conjugated system due to the presence of the butenedioate moiety, which can influence its reactivity and stability. It is likely to exhibit properties typical of both amides and imides, such as potential hydrogen bonding and varied solubility in polar and non-polar solvents. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound's stereochemistry, particularly the (2Z) and (2E) configurations, may play a significant role in its biological activity and interaction with other molecules. Overall, this compound's unique structure and functional groups make it of interest in fields such as medicinal chemistry and materials science.

Formula: C₂₀H₂₆N₄O₅

InChI: InChI=1/C16H22N4O.C4H4O4/c1-19-9-5-8-15(19)18-16(20-10-12-21-13-11-20)17-14-6-3-2-4-7-14;5-3(6)1-2-4(7)8/h2-4,6-7H,5,8-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b17-16-,18-15-;2-1+

Linogliride fumarate

CAS: 78782-47-5

Linogliride fumarate, a guanidine derivative, stimulates insulin release by blocking ATP-sensitive K+ channels, enhancing glucose tolerance.

Formula: C₂₀H₂₆N₄O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 402.451

Ref: TM-T25739L