CAS 78784-70-0

3-chloro-6-(pyridin-2-ylmethyl)pyridazine

Description:

3-Chloro-6-(pyridin-2-ylmethyl)pyridazine is a heterocyclic organic compound characterized by the presence of a pyridazine ring, which is a six-membered ring containing two nitrogen atoms. The compound features a chlorine substituent at the 3-position and a pyridin-2-ylmethyl group at the 6-position, contributing to its unique chemical properties. This structure suggests potential reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The pyridine moiety enhances the compound's ability to engage in coordination with metal ions, making it of interest in coordination chemistry and medicinal chemistry. Additionally, the compound may exhibit biological activity, potentially serving as a scaffold for drug development. Its solubility and stability in various solvents can vary, influenced by the functional groups present. Overall, 3-chloro-6-(pyridin-2-ylmethyl)pyridazine is a compound of interest for further research in synthetic chemistry and pharmacology.

Formula: C₁₀H₈ClN₃

InChI: InChI=1/C10H8ClN3/c11-10-5-4-9(13-14-10)7-8-3-1-2-6-12-8/h1-6H,7H2

SMILES: c1ccnc(c1)Cc1ccc(Cl)nn1

Synonyms:

• Pyridazine, 3-Chloro-6-(2-Pyridinylmethyl)-