CAS 78784-79-9

3-Chloro-6-(3-thienyl)pyridazine

Description:

3-Chloro-6-(3-thienyl)pyridazine is a heterocyclic compound characterized by the presence of both a pyridazine ring and a thienyl group. The pyridazine moiety consists of a six-membered ring containing two nitrogen atoms, which contributes to its aromatic properties and potential reactivity. The chlorine substituent at the 3-position of the pyridazine enhances its electrophilic character, making it a candidate for various chemical reactions. The thienyl group, derived from thiophene, introduces sulfur into the structure, which can influence the compound's electronic properties and solubility. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in agrochemicals or as a building block in organic synthesis. As with many heterocycles, the stability and reactivity of 3-Chloro-6-(3-thienyl)pyridazine can be influenced by environmental factors such as pH and solvent polarity. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₈H₅ClN₂S

InChI: InChI=1S/C8H5ClN2S/c9-8-2-1-7(10-11-8)6-3-4-12-5-6/h1-5H

InChI key: InChIKey=UZCYTUKONSAFBX-UHFFFAOYSA-N

SMILES: ClC1=CC=C(N=N1)C=2C=CSC2

Synonyms:

• Pyridazine, 3-chloro-6-(3-thienyl)-
• 3-Chloro-6-(thiophen-3-yl)pyridazine
• 3-Chloro-6-(3-thienyl)pyridazine
• 3-Chloro-6-thiophen-3-ylpyridazine