CAS 78804-17-8
:Zeylenol
Description:
Zeylenol, with the CAS number 78804-17-8, is a chemical compound that belongs to the class of aromatic alcohols. It is characterized by its unique molecular structure, which typically includes a hydroxyl group (-OH) attached to an aromatic ring. This structure imparts specific physical and chemical properties, such as solubility in organic solvents and potential reactivity in various chemical reactions. Zeylenol is often utilized in the synthesis of fragrances and flavoring agents due to its pleasant aromatic profile. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. The compound's stability, volatility, and interaction with other substances can vary based on environmental conditions, such as temperature and pH. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance. Overall, Zeylenol represents a versatile compound with applications in multiple fields, including chemistry, perfumery, and potentially medicinal chemistry.
Formula:C21H20O7
InChI:InChI=1S/C21H20O7/c22-17-12-11-16(28-20(25)15-9-5-2-6-10-15)18(23)21(17,26)13-27-19(24)14-7-3-1-4-8-14/h1-12,16-18,22-23,26H,13H2/t16-,17+,18+,21-/m1/s1
InChI key:InChIKey=AWCUZBLYCWUTRL-OEMYIYORSA-N
SMILES:C(OC(=O)C1=CC=CC=C1)[C@]2(O)[C@@H](O)[C@H](OC(=O)C3=CC=CC=C3)C=C[C@@H]2O
Synonyms:- Zeylenol
- 5-Cyclohexene-1,2,3,4-tetrol, 2-[(benzoyloxy)methyl]-, 4-benzoate, (1S,2R,3S,4R)-
- 5-Cyclohexene-1,2,3,4-tetrol, 2-[(benzoyloxy)methyl]-, 4-benzoate, [1S-(1α,2β,3β,4α)]-
- (-)-Zeylenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
((1R,2S,5R,6S)-5-(Benzoyloxy)-1,2,6-trihydroxycyclohex-3-en-1-yl)methyl benzoate
CAS:Formula:C21H20O7Purity:95%Molecular weight:384.3793(-)-Zeylenol
CAS:(-)-Zeylenol (Zeylenol) is a natural product derived from the stems of the Uvaria grandiflora, showing anti-inflammatory, antifeedant and antitumor biologicalFormula:C21H20O7Purity:98%Color and Shape:SolidMolecular weight:384.38(-)-Zeylenol
CAS:(-)-Zeylenol is a natural dihydroisocoumarin compound, which is mainly isolated from plants of the Zingiberaceae family. This compound exhibits a complex mode of action, primarily involving the modulation of various cellular pathways. (-)-Zeylenol has been identified for its potential to influence oxidative stress pathways and exhibit anti-inflammatory properties, possibly by interacting with key enzymes and receptors in these biological processes.
Formula:C21H20O7Purity:Min. 95%Molecular weight:384.38 g/mol



