CAS 78821-43-9
:Epibrassinolide
Description:
Epibrassinolide is a plant steroid belonging to the brassinosteroid class, which are known for their role in promoting growth and development in plants. It is characterized by its ability to enhance cell elongation, division, and overall plant vigor. Chemically, epibrassinolide is a polyhydroxylated steroid, featuring multiple hydroxyl groups that contribute to its biological activity. It is typically found in trace amounts in various plant species and is synthesized in response to environmental stimuli. This compound has garnered attention for its potential applications in agriculture, particularly in improving crop yield, stress tolerance, and resistance to pathogens. Additionally, epibrassinolide has been studied for its effects on seed germination and flowering. Its mechanism of action involves the modulation of gene expression and interaction with plant hormone pathways, making it a significant focus in plant physiology research. Overall, epibrassinolide represents a crucial component in the complex network of plant growth regulators, influencing various physiological processes.
Formula:C28H48O6
InChI:InChI=1S/C28H48O6/c1-14(2)15(3)24(31)25(32)16(4)18-7-8-19-17-13-34-26(33)21-11-22(29)23(30)12-28(21,6)20(17)9-10-27(18,19)5/h14-25,29-32H,7-13H2,1-6H3/t15-,16+,17+,18-,19+,20+,21-,22+,23-,24-,25-,27-,28-/m1/s1
InChI key:InChIKey=IXVMHGVQKLDRKH-QHBHMFGVSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@@](C(=O)OC3)(C[C@H](O)[C@H](O)C4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H]([C@H]([C@@H]([C@@H](C(C)C)C)O)O)C)[H])[H]
Synonyms:- (1R,3aS,3bS,6aS,8S,9R,10aR,10bS,12aS)-1-[(1S,2R,3R,4R)-2,3-Dihydroxy-1,4,5-trimethylhexyl]hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-6H-benz[c]indeno[5,4-e]oxepin-6-one
- (22R,23R,24R)-2α,3α,22,23-Tetrahydroxy-B-homo-7-oxa-5α-ergostan-6-one
- (3aS,5S,6R,7aR,7bS,9aS,10R,12aS,12bS)-10-[(2S,3R,4R,5R)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-5,6-dihydroxy-7a,9a-dimethylhexadecahydro-3H-benzo[c]indeno[5,4-e]oxepin-3-one
- (3aS,5S,6R,7aR,7bS,9aS,10R,12aS,12bS)-10-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-5,6-dihydroxy-7a,9a-dimethylhexadecahydro-3H-benzo[c]indeno[5,4-e]oxepin-3-one
- (3aS,5S,6R,7aR,7bS,9aS,12aS,12bS)-10-[(1S,2S,3R,4R)-2,3-dihydroxy-1,4,5-trimethylhexyl]-5,6-dihydroxy-7a,9a-dimethylhexadecahydro-3H-benzo[c]indeno[5,4-e]oxepin-3-one
- 24(R)-Epibrassinolide
- 24-Epibrassinolide
- 24-epi-Brassinolide
- 6H-Benz[c]indeno[5,4-e]oxepin-6-one, 1-(2,3-dihydroxy-1,4,5-trimethylhexyl)hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-, [1R-[1α(1S*,2R*,3R*,4R*),3aβ,3bα,6aβ,8β,9β,10aα,10bβ,12aα]]-
- 6H-Benz[c]indeno[5,4-e]oxepin-6-one, 1-[(1S,2R,3R,4R)-2,3-dihydroxy-1,4,5-trimethylhexyl]hexadecahydro-8,9-dihydroxy-10a,12a-dimethyl-, (1R,3aS,3bS,6aS,8S,9R,10aR,10bS,12aS)-
- B 1105
- B-Homo-7-oxaergostan-6-one, 2,3,22,23-tetrahydroxy-, (2α,3α,5α,22R,23R)-
- Bp 55
- Brassinolide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
24-Epibrassinolide
CAS:24-EpibrassinolideFormula:C28H48O6Purity:95.1% (Typical Value in Batch COA)Color and Shape: white crystalline solidMolecular weight:480.67711g/molEpibrassinolide
CAS:Epibrassinolide (BP55) (EBR) is a biologically active compound of the brassinosteroids, is a natural brassinosteroid (BR) derivative, is a plant regulator withFormula:C28H48O6Purity:97.57% - 98.11%Color and Shape:SolidMolecular weight:480.68Epibrassinolide
CAS:<p>Epibrassinolide is a plant growth regulator, which is a synthetic analog of brassinosteroids derived from natural plant steroids. It exerts its effects through modulating gene expression and activating signaling pathways that enhance cell elongation, division, and differentiation. Additionally, Epibrassinolide plays a crucial role in improving a plant's tolerance to environmental stresses such as drought, salinity, and temperature extremes. It is widely used in agricultural research and practices to boost crop yield and quality. Researchers apply Epibrassinolide to study its potential in promoting growth, increasing resistance to pathogens, and enhancing overall plant vitality. Its applications extend to various plant species, where it is utilized to explore genetic expressions and physiological adaptations in response to its regulatory effects.</p>Formula:C28H48O6Purity:(%) Min. 85%Color and Shape:White PowderMolecular weight:480.68 g/mol






