CAS 78833-04-2

α-(2-Methylpropyl)-2-pyridineacetonitrile

Description:

α-(2-Methylpropyl)-2-pyridineacetonitrile, with the CAS number 78833-04-2, is a chemical compound characterized by its pyridine ring and a nitrile functional group. This substance features a branched alkyl chain, specifically a 2-methylpropyl group, which contributes to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the nitrile group imparts polar characteristics, making it soluble in polar solvents while exhibiting limited solubility in non-polar solvents. This compound may be utilized in various chemical syntheses and applications, particularly in the pharmaceutical and agrochemical industries, due to its potential as an intermediate or building block. Additionally, its structure suggests that it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential uses. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₄N₂

InChI: InChI=1S/C11H14N2/c1-9(2)7-10(8-12)11-5-3-4-6-13-11/h3-6,9-10H,7H2,1-2H3

InChI key: InChIKey=GPMCJRHRMGDKEE-UHFFFAOYSA-N

SMILES: C(CC(C)C)(C#N)C1=CC=CC=N1

Synonyms:

• 2-Pyridineacetonitrile, α-(2-methylpropyl)-
• 278-990-0
• 4-Methyl-2-(2-Pyridyl)Pentanenitrile
• α-(2-Methylpropyl)-2-pyridineacetonitrile