CymitQuimica logo

CAS 78840-05-8

:

19,21-Dimethoxy-3,6,9,12,15-pentaoxabicyclo[15.3.1]heneicosa-1(21),17,19-triene

Description:
19,21-Dimethoxy-3,6,9,12,15-pentaoxabicyclo[15.3.1]heneicosa-1(21),17,19-triene is a complex organic compound characterized by its unique bicyclic structure and multiple ether linkages. The presence of five methoxy groups contributes to its solubility and reactivity, while the bicyclic framework imparts rigidity to the molecule. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of novel polymers or as a precursor for more complex chemical entities. The specific arrangement of the ether groups and the triene system suggests interesting electronic properties, which may be exploited in photonic or electronic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and solvent polarity. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, this compound exemplifies the intricate design possible in organic chemistry, showcasing the interplay between structure and function.
Formula:C18H28O7
InChI:InChI=1S/C18H28O7/c1-19-17-11-15-13-24-9-7-22-5-3-21-4-6-23-8-10-25-14-16(12-17)18(15)20-2/h11-12H,3-10,13-14H2,1-2H3
InChI key:InChIKey=XVTPRRBMIGGDSJ-UHFFFAOYSA-N
SMILES:O(C)C=1C2=CC(OC)=CC1COCCOCCOCCOCCOC2
Synonyms:
  • 19,21-Dimethoxy-3,6,9,12,15-pentaoxabicyclo[15.3.1]heneicosa-1(21),17,19-triene
  • 3,6,9,12,15-Pentaoxabicyclo[15.3.1]heneicosa-1(21),17,19-triene, 19,21-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.