CAS 78846-88-5

2-chloro-6-(chloromethyl)pyridine

Description:

2-Chloro-6-(chloromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with chlorine atoms. The molecular structure features a chlorine atom at the 2-position and a chloromethyl group (-CH2Cl) at the 6-position of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity due to the presence of both chlorine substituents, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. 2-Chloro-6-(chloromethyl)pyridine is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its ability to serve as an intermediate in the formation of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage and disposal methods are essential to mitigate environmental impact.

Formula: C₆H₅Cl₂N

InChI: InChI=1/C6H5Cl2N/c7-4-5-2-1-3-6(8)9-5/h1-3H,4H2

SMILES: c1cc(CCl)nc(c1)Cl

Synonyms:

• Pyridine, 2-Chloro-6-(Chloromethyl)-

2-Chloro-6-(chloromethyl)pyridine

CAS: 78846-88-5

Formula: C₆H₅Cl₂N

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.0166

Ref: IN-DA003GZV

2-Chloro-6-(chloromethyl)pyridine

CAS: 78846-88-5

2-Chloro-6-(chloromethyl)pyridine

Formula: C₆H₅Cl₂N

Purity: 98%

Color and Shape: beige crystalline powder

Molecular weight: 162.02g/mol

Ref: 54-OR303732

2-Chloro-6-(chloromethyl)pyridine

CAS: 78846-88-5

Formula: C₆H₅Cl₂N

Purity: 95%

Color and Shape: Solid, Crystalline

Molecular weight: 162.01

Ref: 10-F236925

2-Chloro-6-(chloromethyl)pyridine

CAS: 78846-88-5

2-Chloro-6-(chloromethyl)pyridine (2C6CP) is a chloride precursor that can be used for the synthesis of metal chlorides, such as copper chlorides. 2C6CP is synthesized by reacting thionyl chloride with the substituted pyridine under anhydrous conditions at -78°C. The resultant 2C6CP is then hydrolyzed to produce the desired chloride.
2C6CP has been shown to act as a ligand in coordination chemistry. It was first synthesized by reacting 3-chloropyridine with thionyl chloride and then hydrolyzing it to 2-chloropyridine. This method was later modified to use 4-chlorobenzoyl chloride instead of 3-chloropyridine, producing 2,4-dichloropyridine.

Formula: C₆H₅Cl₂N

Purity: Min. 95%

Molecular weight: 162.02 g/mol

Ref: 3D-DDA84688