CAS 78848-93-8
:(3xi,8alpha,9S)-9-hydroxy-10,11-dihydrocinchonan-1-ium hydrogen sulfate
Description:
The chemical substance known as (3xi,8alpha,9S)-9-hydroxy-10,11-dihydrocinchonan-1-ium hydrogen sulfate, with the CAS number 78848-93-8, is a quaternary ammonium compound derived from cinchona alkaloids. It features a complex bicyclic structure that includes a hydroxyl group, contributing to its solubility and reactivity. This compound is characterized by its chiral centers, which impart specific stereochemical properties that can influence its biological activity. As a hydrogen sulfate salt, it exhibits ionic characteristics, enhancing its solubility in polar solvents, particularly water. The presence of the hydroxy group suggests potential for hydrogen bonding, which may affect its interaction with biological systems. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, including antimalarial and analgesic properties, owing to its structural similarity to other cinchona derivatives. Its stability, solubility, and reactivity make it a subject of study in various chemical and pharmaceutical contexts.
Formula:C19H26N2O5S
InChI:InChI=1/C19H24N2O.H2O4S/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;1-5(2,3)4/h3-7,9,13-14,18-19,22H,2,8,10-12H2,1H3;(H2,1,2,3,4)/t13?,14?,18-,19-;/m0./s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
