CAS 78859-36-6
:1-methyl-6H-2,5,6a,7-tetraazafluoranthen-3-amine
Description:
1-Methyl-6H-2,5,6a,7-tetraazafluoranthen-3-amine, identified by its CAS number 78859-36-6, is a heterocyclic organic compound characterized by a complex structure that includes multiple nitrogen atoms within its ring system. This compound belongs to the class of tetraazafluoranthenes, which are derivatives of fluoranthene, a polycyclic aromatic hydrocarbon. The presence of nitrogen atoms in its structure contributes to its unique chemical properties, including potential basicity and reactivity. Typically, such compounds may exhibit interesting electronic properties, making them of interest in materials science and organic electronics. Additionally, the methyl group attached to the nitrogen influences its solubility and stability. The compound may also have implications in biological systems, although specific biological activity would require further investigation. Overall, 1-methyl-6H-2,5,6a,7-tetraazafluoranthen-3-amine represents a fascinating area of study within organic and medicinal chemistry, with potential applications in various fields.
Formula:C13H11N5
InChI:InChI=1/C13H11N5/c1-7-10-8-3-2-4-16-13(8)18-6-15-5-9(11(10)18)12(14)17-7/h2-5H,6H2,1H3,(H2,14,17)
SMILES:Cc1c2c3cccnc3n3CN=Cc(c23)c(=N)[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
