CAS 78859-42-4
:5'-(4-fluorosulfonylbenzoyl)adenosine hydrochloride
Description:
5'-(4-Fluorosulfonylbenzoyl)adenosine hydrochloride is a chemical compound that belongs to the class of nucleoside analogs. It features an adenosine backbone, which is a key component of various biological molecules, including ATP. The presence of a 4-fluorosulfonylbenzoyl group enhances its reactivity and potential for biological activity, particularly in the context of enzyme inhibition or modulation. This compound is typically used in biochemical research, particularly in studies involving nucleoside metabolism and signaling pathways. Its hydrochloride form indicates that it is a salt, which can influence its solubility and stability in aqueous solutions. The fluorosulfonyl group is known for its electrophilic properties, making this compound a candidate for further chemical modifications or as a probe in biological assays. As with many chemical substances, handling should be done with care, considering potential toxicity and reactivity. Overall, 5'-(4-fluorosulfonylbenzoyl)adenosine hydrochloride serves as a valuable tool in the field of medicinal chemistry and pharmacology.
Formula:C17H17ClFN5O7S
InChI:InChI=1/C17H16FN5O7S.ClH/c18-31(27,28)9-3-1-8(2-4-9)17(26)29-5-10-12(24)13(25)16(30-10)23-7-22-11-14(19)20-6-21-15(11)23;/h1-4,6-7,10,12-13,16,24-25H,5H2,(H2,19,20,21);1H/t10-,12-,13-,16-;/m1./s1
SMILES:c1cc(ccc1C(=O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)S(=O)(=O)F.Cl
Synonyms:- 5'-(4-(Fluorosulfonyl)benzoyl)adenosine
- 5'-(Para-(fluorosulfonyl)benzoyl)adenosine
- 5-Fsba
- 5'-O-[4-(fluorosulfonyl)benzoyl]adenosine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5''-(4-Fluorosulfonylbenzoyl)adenosine hydrochloride
CAS:Formula:C17H16FN5O7S·HClPurity:(HPLC) ≥ 98.0%Color and Shape:White to off-white powderMolecular weight:489.865'-(4-Fluorosulfonylbenzoyl)adenosine HCI
CAS:<p>5'-(4-Fluorosulfonylbenzoyl)adenosine HCI is an inhibitor of adenosine deaminase. It has been used as a tool in the diagnosis of autoimmune diseases. 5'-(4-Fluorosulfonylbenzoyl)adenosine HCI binds to the α subunit of mitochondrial ATPase and inhibits its function, leading to a drop in mitochondrial membrane potential. This can be measured by electron paramagnetic resonance spectroscopy, which can detect changes in redox potentials and the presence of disulfide bonds. 5'-(4-Fluorosulfonylbenzoyl)adenosine HCI also binds to DNA synthetase and metal chelate, inhibiting protein synthesis.<br>5'-(4-Fluorosulfonylbenzoyl)adenosine HCI has been shown to inhibit various enzymes such as phosphofructokinase, glycogen phosph</p>Formula:C17H17ClFN5O7SPurity:Min. 97.0 Area-%Molecular weight:489.86 g/molRef: 3D-W-203807
1gTo inquire100mgTo inquire250mgTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquire5'-(4-Fluorosulfonylbenzoyl)adenosine HCI
CAS:<p>ATP analog; covalent inhibitor of anthrax edema factor</p>Formula:C17H17ClFN5O7SPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:489.86 g/molFSBA hydrochloride
CAS:FSBA hydrochloride(5'-p-Fluorosulfonylbenzoyladenosine) is an ATP analogue serving as an affinity probe for the ATP site of Na/K-ATPase.Formula:C17H17ClFN5O7SPurity:97.96%Color and Shape:SolidMolecular weight:489.86



