CymitQuimica logo

CAS 78859-46-8

:

[(2S,5S)-3,6-dioxo-5-(propan-2-yl)piperazin-2-yl]acetic acid

Description:
The chemical substance known as [(2S,5S)-3,6-dioxo-5-(propan-2-yl)piperazin-2-yl]acetic acid, with the CAS number 78859-46-8, is a piperazine derivative characterized by its unique structural features. It contains a piperazine ring, which is a six-membered cyclic amine, and is substituted with a propan-2-yl group and two carbonyl (oxo) groups, contributing to its reactivity and potential biological activity. The presence of the acetic acid moiety indicates that it has acidic properties, which may influence its solubility and interaction with biological systems. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its stereochemistry, indicated by the (2S,5S) configuration, suggests specific spatial arrangements that can affect its biological activity and interactions with receptors or enzymes. Overall, this compound's characteristics, including its functional groups and stereochemistry, play a crucial role in determining its chemical behavior and potential applications in pharmaceuticals or other fields.
Formula:C9H14N2O4
InChI:InChI=1/C9H14N2O4/c1-4(2)7-9(15)10-5(3-6(12)13)8(14)11-7/h4-5,7H,3H2,1-2H3,(H,10,15)(H,11,14)(H,12,13)/t5-,7-/m0/s1
SMILES:CC(C)[C@H]1C(=N[C@@H](CC(=O)O)C(=N1)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.