CAS 78860-79-4

α-[2-(4-Bromophenyl)-2-oxoethyl]-1H-indole-3-acetic acid

Description:

α-[2-(4-Bromophenyl)-2-oxoethyl]-1H-indole-3-acetic acid, with the CAS number 78860-79-4, is a synthetic compound that belongs to the class of indole derivatives. This substance features a distinctive indole ring structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of a 4-bromophenyl group and a ketoethyl moiety contributes to its unique chemical properties. This compound is of interest in medicinal chemistry due to its potential biological activities, which may include anti-inflammatory and anticancer effects. Its molecular structure allows for various interactions with biological targets, making it a candidate for further pharmacological studies. Additionally, the presence of functional groups such as the carboxylic acid enhances its solubility and reactivity, which can influence its behavior in biological systems. As with many synthetic compounds, understanding its stability, reactivity, and potential toxicity is crucial for its application in research and development.

Formula: C₁₈H₁₄BrNO₃

InChI: InChI=1S/C18H14BrNO3/c19-12-7-5-11(6-8-12)17(21)9-14(18(22)23)15-10-20-16-4-2-1-3-13(15)16/h1-8,10,14,20H,9H2,(H,22,23)

InChI key: InChIKey=UKZWMJMQQLWAET-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC=C(Br)C=C1)(C(O)=O)C=2C=3C(NC2)=CC=CC3

Synonyms:

• α-[2-(4-Bromophenyl)-2-oxoethyl]-1H-indole-3-acetic acid
• 1H-Indole-3-acetic acid, α-[2-(4-bromophenyl)-2-oxoethyl]-

4-(4-Bromophenyl)-2-indol-3-yl-4-oxobutanoic acid

CAS: 78860-79-4

Please enquire for more information about 4-(4-Bromophenyl)-2-indol-3-yl-4-oxobutanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₈H₁₄BrNO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 372.21 g/mol

Ref: 3D-FB169485