
CAS 78876-53-6
:1-Chloro-6-(5-ethynyl-2-thienyl)-3,5-hexadiyn-2-ol
Description:
1-Chloro-6-(5-ethynyl-2-thienyl)-3,5-hexadiyn-2-ol is a complex organic compound characterized by its unique structural features, including a chloro group, a thienyl moiety, and multiple alkyne functionalities. The presence of the chloro substituent indicates potential reactivity, particularly in nucleophilic substitution reactions. The ethynyl group contributes to the compound's unsaturation and can participate in various coupling reactions, making it useful in synthetic organic chemistry. The hexadiyn-2-ol backbone suggests the presence of multiple triple bonds, which can impart distinct physical properties such as increased rigidity and potential for π-π stacking interactions. Additionally, the hydroxyl group (alcohol) can engage in hydrogen bonding, influencing solubility and reactivity. This compound may exhibit interesting electronic properties due to the conjugation between the thienyl ring and the alkyne chains, potentially making it relevant in materials science or organic electronics. Overall, its unique structure positions it as a versatile intermediate in organic synthesis and materials development.
Formula:C12H7ClOS
InChI:InChI=1S/C12H7ClOS/c1-2-11-7-8-12(15-11)6-4-3-5-10(14)9-13/h1,7-8,10,14H,9H2
InChI key:InChIKey=FGVSQYJMADNDRE-UHFFFAOYSA-N
SMILES:C(#CC#CC(CCl)O)C=1SC(C#C)=CC1
Synonyms:- 1-Chloro-6-(5-ethynyl-2-thienyl)-3,5-hexadiyn-2-ol
- 3,5-Hexadiyn-2-ol, 1-chloro-6-(5-ethynyl-2-thienyl)-
- 1-Chloro-6-(5-ethynylthiophen-2-yl)hexa-3,5-diyn-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
