CAS 78879-20-6
:N-BOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid
Description:
N-BOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroisoquinoline moiety. The "N-BOC" designation indicates that the amine group is protected by a tert-butyloxycarbonyl (BOC) group, which is commonly used in organic synthesis to temporarily protect amines during chemical reactions. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical transformations. It is often utilized in the synthesis of pharmaceuticals and biologically active molecules due to its structural resemblance to important neurotransmitters and alkaloids. The presence of the tetrahydroisoquinoline framework makes it a valuable intermediate in medicinal chemistry. Additionally, the compound is typically handled under standard laboratory conditions, and its stability can be influenced by factors such as pH and temperature. As with many organic compounds, proper safety measures should be observed when handling this substance, including the use of personal protective equipment and adherence to safety protocols.
Formula:C15H18NO4
InChI:InChI=1/C15H19NO4/c1-15(2,3)20-14(19)16-9-11-7-5-4-6-10(11)8-12(16)13(17)18/h4-7,12H,8-9H2,1-3H3,(H,17,18)/p-1/t12-/m0/s1
SMILES:CC(C)(C)OC(=O)N1Cc2ccccc2C[C@H]1C(=O)[O-]
Synonyms:- Boc-L-Tetrahydroisoquinoline-3-COOH
- Boc-L-Tic
- Boc-L-Tic-OH
- Boc-Tic-Oh
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(S)-2-(tert-Butoxycarbonyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic Acid
CAS:Formula:C15H19NO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:277.32Boc-Tic-OH
CAS:Formula:C15H19NO4Color and Shape:White to off-white crystalline powderMolecular weight:277.32(3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid, N-BOC protected
CAS:<p>(3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid, N-BOC protected</p>Formula:C15H19NO4Purity:98%Color and Shape: white solidMolecular weight:277.32g/molBoc-(3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid
CAS:<p>Boc-(3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid is an amino acid that has the δ-opioid receptor antagonist activity. It can be synthesized by a stepwise synthesis with an asymmetric center. The δ-opioid receptor antagonist activity of Boc-(3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid was found to be comparable to naloxone in terms of affinity constants and functional groups.</p>Formula:C15H19NO4Purity:Min. 95%Color and Shape:SolidMolecular weight:277.32 g/mol(S)-2-tert-Butoxycarbonyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
CAS:Formula:C15H19NO4Purity:98%Color and Shape:Solid, Crystalline PowderMolecular weight:277.32





