CAS 78880-65-6

10,11-Dihydro-10-oxo-5H-dibenz[b,f]azepine-5-carbonitrile

Description:

10,11-Dihydro-10-oxo-5H-dibenz[b,f]azepine-5-carbonitrile, with the CAS number 78880-65-6, is a heterocyclic compound characterized by its unique dibenzazepine structure, which incorporates a carbonitrile functional group and a ketone. This compound features a fused bicyclic system that contributes to its stability and potential biological activity. The presence of the carbonitrile group suggests that it may exhibit polar characteristics, influencing its solubility and reactivity. Additionally, the ketone functionality can participate in various chemical reactions, such as nucleophilic additions or reductions. The compound's structure may also allow for interactions with biological targets, making it of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 10,11-Dihydro-10-oxo-5H-dibenz[b,f]azepine-5-carbonitrile represents a complex organic molecule with potential applications in pharmaceuticals and materials science.

Formula: C₁₅H₁₀N₂O

InChI: InChI=1/C15H10N2O/c16-10-17-13-7-3-1-5-11(13)9-15(18)12-6-2-4-8-14(12)17/h1-8H,9H2

InChI key: InChIKey=JUGKQCJQHACNBE-UHFFFAOYSA-N

SMILES: C(#N)N1C=2C(C(=O)CC=3C1=CC=CC3)=CC=CC2

Synonyms:

• 10-oxo-10,11-dihydro-5H-dibenzo[b,f]azepine-5-carbonitrile
• 5H-Dibenz[b,f]azepine-5-carbonitrile, 10,11-dihydro-10-oxo-
• 10,11-Dihydro-10-oxo-5H-dibenz(b,f)azepine-5-carbonitrile
• 10,11-Dihydro-10-oxo-5H-dibenz[b,f]azepine-5-carbonitrile
• Oxcarbazepine Impurity 14
• Oxcarbazepine Impurity 15

Carbamazepine Impurity 3

CAS: 78880-65-6

Formula: C₁₅H₁₀N₂O

Molecular weight: 234.26

Ref: 4Z-C-1926