
CAS 78886-52-9
:1,4-Isoquinolinediamine
Description:
1,4-Isoquinolinediamine, with the CAS number 78886-52-9, is an organic compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. This compound contains two amino groups (-NH2) located at the 1 and 4 positions of the isoquinoline ring, contributing to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino groups. The compound is of interest in medicinal chemistry and materials science, as it can serve as a building block for the synthesis of more complex molecules, including pharmaceuticals and dyes. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. Safety precautions should be taken when working with this compound, as with many amines, due to potential toxicity and reactivity.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c10-8-5-12-9(11)7-4-2-1-3-6(7)8/h1-5H,10H2,(H2,11,12)
InChI key:InChIKey=GIIUSHQTYGRABO-UHFFFAOYSA-N
SMILES:NC=1C2=C(C(N)=NC1)C=CC=C2
Synonyms:- 1,4-Isoquinolinediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.