CAS 78886-53-0
:4-Amino-1(2H)-isoquinolinone
Description:
4-Amino-1(2H)-isoquinolinone is an organic compound characterized by its isoquinoline structure, which features a fused bicyclic system consisting of a benzene ring and a pyridine ring. This compound contains an amino group (-NH2) and a keto group (C=O) at specific positions on the isoquinoline framework, contributing to its reactivity and potential biological activity. It is typically a crystalline solid, and its solubility can vary depending on the solvent used. The presence of the amino group allows for hydrogen bonding, which can influence its interactions in biological systems. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of anti-cancer and anti-inflammatory agents. Additionally, its structural features may facilitate further modifications to enhance its pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c10-8-5-11-9(12)7-4-2-1-3-6(7)8/h1-5H,10H2,(H,11,12)
InChI key:InChIKey=VMLHPUMZIKVELK-UHFFFAOYSA-N
SMILES:NC=1C=2C(C(=O)NC1)=CC=CC2
Synonyms:- 1(2H)-Isoquinolinone, 4-amino-
- 4-Aminoisoquinolin-1-ol
- 4-Amino-1(2H)-isoquinolinone
- Isocarbostyril, 4-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
