CAS 78887-39-5
:3-Acetamidobenzeneboronic acid
Description:
3-Acetamidobenzeneboronic acid, with the CAS number 78887-39-5, is an organic compound that features both a boronic acid functional group and an acetamide substituent on a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid group, which can form hydrogen bonds. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The acetamide group contributes to the compound's stability and solubility characteristics. 3-Acetamidobenzeneboronic acid can be utilized in Suzuki coupling reactions, a key method in the formation of carbon-carbon bonds, which is essential in the synthesis of pharmaceuticals and agrochemicals. Additionally, its unique structure allows for potential applications in sensor technology and materials science, particularly in the development of boron-containing polymers and compounds.
Formula:C8H10BNO3
InChI:InChI=1/C8H10BNO3/c1-6(11)10-8-4-2-3-7(5-8)9(12)13/h2-5,12-13H,1H3,(H,10,11)
SMILES:CC(=Nc1cccc(c1)B(O)O)O
Synonyms:- (3-Acetylaminophenyl)boronic acid
- 3-Acetamidophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Acetamidobenzeneboronic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H10BNO3Purity:98%Color and Shape:Pale cream to cream to pale brown, Crystals or powder or crystalline powderMolecular weight:178.983-Acetamidophenylboronic acid
CAS:Formula:C8H10BNO3Purity:98%Color and Shape:SolidMolecular weight:178.98093-Acetamidobenzeneboronic acid
CAS:3-Acetamidobenzeneboronic acidFormula:C8H10BNO3Purity:98%Color and Shape: off-white powderMolecular weight:178.98g/mol3-Acetamidophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H10BNO3Color and Shape:White to Yellow powder to crystalMolecular weight:178.983-Acetamidophenylboronic acid
CAS:Formula:C8H10BNO3Purity:95%Color and Shape:SolidMolecular weight:178.98





