CAS 789-76-4

4-[(Z)-2-(4-quinolyl)vinyl]phenol

Description:

4-[(Z)-2-(4-quinolyl)vinyl]phenol, identified by its CAS number 789-76-4, is an organic compound characterized by its phenolic structure and a vinyl group attached to a quinoline moiety. This compound typically exhibits a strong absorption in the ultraviolet-visible spectrum due to the presence of conjugated double bonds, which can also contribute to its potential as a fluorescent dye. The Z configuration indicates that the vinyl group and the quinoline ring are oriented in a specific geometric arrangement, influencing its reactivity and interaction with other molecules. It is often studied for its potential applications in organic electronics, photonics, and as a ligand in coordination chemistry. Additionally, the presence of the quinoline ring may impart biological activity, making it of interest in medicinal chemistry. The compound is generally soluble in organic solvents, and its properties can be influenced by factors such as pH and solvent polarity. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₇H₁₃NO

InChI: InChI=1/C17H13NO/c19-15-9-6-13(7-10-15)5-8-14-11-12-18-17-4-2-1-3-16(14)17/h1-12,19H/b8-5-

SMILES: c1ccc2c(c1)c(/C=C\c1ccc(cc1)O)ccn2