CAS 78907-07-0

Methyl α-(cyclohexylamino)benzeneacetate

Description:

Methyl α-(cyclohexylamino)benzeneacetate, identified by its CAS number 78907-07-0, is an organic compound characterized by its ester functional group, which is formed from the reaction of an acid and an alcohol. This compound features a cyclohexylamino group attached to a benzeneacetate moiety, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the cyclohexylamino group suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, as amines often play crucial roles in drug development. The compound's solubility can vary, but esters generally exhibit moderate solubility in organic solvents. Its molecular structure may impart specific reactivity patterns, making it of interest in various chemical reactions, including nucleophilic substitutions or coupling reactions. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₅H₂₁NO₂

InChI: InChI=1S/C15H21NO2/c1-18-15(17)14(12-8-4-2-5-9-12)16-13-10-6-3-7-11-13/h2,4-5,8-9,13-14,16H,3,6-7,10-11H2,1H3

InChI key: InChIKey=GIERMKQJVHUGLN-UHFFFAOYSA-N

SMILES: C(NC1CCCCC1)(C(OC)=O)C2=CC=CC=C2

Synonyms:

• Methyl α-(cyclohexylamino)benzeneacetate
• Benzeneacetic acid, α-(cyclohexylamino)-, methyl ester