CAS 78917-44-9
:ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate
Description:
Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate, with the CAS number 78917-44-9, is an organic compound that belongs to the class of esters. It features a benzofuran moiety, which contributes to its aromatic characteristics, and a propanoate functional group that enhances its reactivity. This compound is typically characterized by its moderate solubility in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic benzofuran structure. Ethyl 3-(1-benzofuran-2-yl)-3-oxopropanoate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in the synthesis of more complex molecules or as a precursor in various chemical reactions. Additionally, the presence of the carbonyl group in the oxopropanoate portion may allow for further functionalization, making it a versatile intermediate in organic synthesis. As with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C13H12O4
InChI:InChI=1/C13H12O4/c1-2-16-13(15)8-10(14)12-7-9-5-3-4-6-11(9)17-12/h3-7H,2,8H2,1H3
SMILES:CCOC(=O)CC(=O)c1cc2ccccc2o1
Synonyms:- 2-Benzofuranpropanoic Acid, Β-Oxo-, Ethyl Ester
- Ethyl 3-(Benzo[B]Furan-2-Yl)-3-Oxopropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
