CAS 78941-94-3
:7-Chloro-6-methylquinoline
Description:
7-Chloro-6-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that consists of a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 7-position and a methyl group at the 6-position of the quinoline structure, which influences its chemical reactivity and properties. It is typically a yellow to brown solid with moderate solubility in organic solvents. The presence of the chlorine atom can enhance its biological activity, making it of interest in medicinal chemistry, particularly for its potential antimicrobial and antitumor properties. Additionally, the methyl group may affect its electronic properties and steric hindrance, influencing its interactions with biological targets. As with many halogenated compounds, 7-chloro-6-methylquinoline may exhibit unique reactivity patterns, including electrophilic substitution and nucleophilic attack, making it a valuable compound for synthetic applications in organic chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H8ClN
InChI:InChI=1S/C10H8ClN/c1-7-5-8-3-2-4-12-10(8)6-9(7)11/h2-6H,1H3
InChI key:InChIKey=DLKVFICCIWHLGF-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1Cl)N=CC=C2
Synonyms:- 6-Methyl-7-Chloroquinoline
- 7-Chlor-6-methyl-chinolin
- 7-Chloro-6-Methyl-Quinoline
- Quinoline, 7-chloro-6-methyl-
- 7-Chloro-6-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
