
CAS 78946-83-5
:1,4,7,10,13-Pentaoxa-16-azacyclooctadecane, 14,18-dimethyl-, (14R*,18R*)-
Description:
1,4,7,10,13-Pentaoxa-16-azacyclooctadecane, 14,18-dimethyl-, (14R*,18R*)- is a complex organic compound characterized by its unique cyclic structure that includes both nitrogen and oxygen atoms. This compound features a macrocyclic framework, which is significant in coordination chemistry and can form stable complexes with metal ions. The presence of multiple ether (–O–) and amine (–N–) functional groups contributes to its solubility in polar solvents and enhances its potential for forming hydrogen bonds. The specific stereochemistry indicated by the (14R*,18R*) designation suggests that the compound has defined spatial arrangements, which can influence its biological activity and interaction with other molecules. Such compounds are often studied for their potential applications in fields like medicinal chemistry, materials science, and catalysis due to their ability to act as ligands or scaffolds in various chemical reactions. Overall, the structural features of this compound make it a subject of interest for further research in both synthetic and applied chemistry.
Formula:C14H29NO5
InChI:InChI=1/C14H29NO5/c1-13-11-15-12-14(2)20-10-8-18-6-4-16-3-5-17-7-9-19-13/h13-15H,3-12H2,1-2H3/t13-,14-/s2
InChI key:InChIKey=FVBSVZZRWQOUPT-ZCWZLOQUNA-N
SMILES:C[C@H]1CNC[C@H](C)OCCOCCOCCOCCO1
Synonyms:- 1,4,7,10,13-Pentaoxa-16-azacyclooctadecane, 14,18-dimethyl-, (14R*,18R*)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4,7,10,13-Pentaoxa-16-azacyclooctadecane,14,18-dimethyl-, (14R*,18R*)- (9CI)
CAS:Formula:C14H29NO5Molecular weight:291.3838
