CAS 789489-52-7

O-(1,2-Dimethylpropyl)hydroxylamine

Description:

O-(1,2-Dimethylpropyl)hydroxylamine is an organic compound characterized by the presence of a hydroxylamine functional group (-NH2OH) attached to a branched alkyl chain. This compound features a 1,2-dimethylpropyl group, which contributes to its unique structural and chemical properties. Hydroxylamines are known for their reactivity, particularly in redox reactions, and can act as nucleophiles due to the presence of the nitrogen atom with a lone pair of electrons. The branched structure of the 1,2-dimethylpropyl group may influence the compound's steric hindrance, potentially affecting its reactivity and interactions with other molecules. O-(1,2-Dimethylpropyl)hydroxylamine may be utilized in various chemical syntheses, including the preparation of amines and other nitrogen-containing compounds. Additionally, it may exhibit specific solubility characteristics in polar solvents due to the hydroxylamine group, which can engage in hydrogen bonding. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₅H₁₃NO

InChI: InChI=1S/C5H13NO/c1-4(2)5(3)7-6/h4-5H,6H2,1-3H3

InChI key: InChIKey=RABQKJIIPCWRLL-UHFFFAOYSA-N

SMILES: C(C(C)C)(ON)C

Synonyms:

• Hydroxylamine, O-(1,2-dimethylpropyl)-
• O-(1,2-Dimethylpropyl)hydroxylamine