
CAS 78950-79-5
:5,6,7,8-Tetrahydro-6-(methylamino)-1-naphthalenol
Description:
5,6,7,8-Tetrahydro-6-(methylamino)-1-naphthalenol, with the CAS number 78950-79-5, is an organic compound characterized by its naphthalene structure, which is a bicyclic aromatic hydrocarbon. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the naphthalene ring, resulting in a saturated structure. The presence of a methylamino group (-NH(CH3)2) at the 6-position contributes to its potential biological activity, as amines often play significant roles in pharmacology. The hydroxyl group (-OH) at the 1-position enhances its polarity and solubility in polar solvents, which can influence its reactivity and interaction with biological systems. This compound may exhibit various properties, including potential antioxidant activity, and could be of interest in medicinal chemistry for its possible therapeutic applications. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation through empirical studies.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-12-9-5-6-10-8(7-9)3-2-4-11(10)13/h2-4,9,12-13H,5-7H2,1H3
InChI key:InChIKey=ABAQJEVFDPFOKG-UHFFFAOYSA-N
SMILES:OC1=C2C(CC(NC)CC2)=CC=C1
Synonyms:- 5,6,7,8-Tetrahydro-6-(methylamino)-1-naphthalenol
- 1-Naphthalenol, 5,6,7,8-tetrahydro-6-(methylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.