CAS 78954-23-1

Yakuchinone A

Description:

Yakuchinone A is a naturally occurring compound classified as a sesquiterpenoid, primarily derived from the plant species *Artemisia yakuchinensis*. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and biological activities. This compound exhibits notable pharmacological effects, including anti-inflammatory, antioxidant, and potential anticancer properties, making it a subject of interest in medicinal chemistry and natural product research. Yakuchinone A is typically isolated through extraction methods from the plant and can be analyzed using various spectroscopic techniques, such as NMR and mass spectrometry, to confirm its structure. Its solubility profile is generally moderate, and it may interact with various biological targets, which is essential for its therapeutic potential. Ongoing studies aim to elucidate its mechanisms of action and explore its applications in drug development. Overall, Yakuchinone A represents a significant compound in the field of natural products with promising implications for health and medicine.

Formula: C₂₀H₂₄O₃

InChI: InChI=1/C20H24O3/c1-23-20-15-17(12-14-19(20)22)11-13-18(21)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,12,14-15,22H,5-6,9-11,13H2,1H3

InChI key: InChIKey=TXELARZTKDBEKS-UHFFFAOYSA-N

SMILES: C(CC(CCCCC1=CC=CC=C1)=O)C2=CC(OC)=C(O)C=C2

Synonyms:

• 1-(4-Hydroxy-3-methoxyphenyl)-7-phenyl-3-heptanone
• 3-Heptanone, 1-(4-hydroxy-3-methoxyphenyl)-7-phenyl-
• Yakuchinone A

Yakuchinone A

CAS: 78954-23-1

Yakuchinone A

Purity: ≥98%

Molecular weight: 312.4g/mol

Ref: 54-BUP03137

Yakuchinone A

CAS: 78954-23-1

Formula: C₂₀H₂₄O₃

Purity: 95%~99%

Molecular weight: 312.409

Ref: BP-BP4088

Yakuchinone A

CAS: 78954-23-1

Yakuchinone A from Alpinia oxyphylla inhibits prostaglandins, leukotrienes, COX-2, and iNOS synthesis.

Formula: C₂₀H₂₄O₃

Purity: 98.48%

Color and Shape: Solid

Molecular weight: 312.4

Ref: TM-T24417

Yakuchinone A

CAS: 78954-23-1

Formula: C₂₀H₂₄O₃

Purity: >98.0%(HPLC)

Color and Shape: Colorless to Yellow to Orange clear liquid

Molecular weight: 312.41

Ref: 3B-Y0022