CAS 78955-90-5

methyl 4-chloro-2-methoxybenzoate

Description:

Methyl 4-chloro-2-methoxybenzoate, with the CAS number 78955-90-5, is an organic compound belonging to the class of benzoates. It features a methoxy group (-OCH3) and a chloro substituent (-Cl) on a benzoate ring, which contributes to its chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is characterized by its aromatic structure, which imparts stability and influences its reactivity. Methyl 4-chloro-2-methoxybenzoate is often used in organic synthesis as an intermediate for the production of various pharmaceuticals and agrochemicals. Its solubility in organic solvents, such as ethanol and dichloromethane, makes it useful in various chemical reactions. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₉H₉ClO₃

InChI: InChI=1/C9H9ClO3/c1-12-8-5-6(10)3-4-7(8)9(11)13-2/h3-5H,1-2H3

SMILES: COc1cc(ccc1C(=O)OC)Cl

Methyl 4-chloro-2-methoxybenzoate

CAS: 78955-90-5

Formula: C₉H₉ClO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.6190

Ref: IN-DA008ND4

Methyl 4-chloro-2-methoxybenzoate

CAS: 78955-90-5

Methyl 4-chloro-2-methoxybenzoate

Formula: C₉H₉ClO₃

Purity: 97%

Color and Shape: colourless liquid

Molecular weight: 200.61896g/mol

Ref: 54-OR11925

Methyl 4-chloro-2-methoxybenzoate

CAS: 78955-90-5

Formula: C₉H₉ClO₃

Purity: 95%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 200.62

Ref: 10-F236518