CAS 78957-86-5

3-{[(5-chloronaphthalen-1-yl)sulfonyl]amino}propan-1-aminium chloride

Description:

3-{[(5-Chloronaphthalen-1-yl)sulfonyl]amino}propan-1-aminium chloride is a chemical compound characterized by its unique structure, which includes a naphthalene moiety substituted with a chlorine atom and a sulfonamide functional group. This compound features a propan-1-aminium group, indicating the presence of a positively charged amine, which contributes to its solubility in polar solvents. The sulfonyl group enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The chloride ion serves as a counterion, stabilizing the cationic form of the compound. This substance may exhibit biological activity due to its structural components, making it of interest in drug design and synthesis. Its properties, such as melting point, solubility, and reactivity, would be influenced by the presence of the chloronaphthyl and sulfonamide groups, which can affect interactions with biological targets. Overall, this compound represents a class of sulfonamide derivatives that may have significant implications in various chemical and biological applications.

Formula: C₁₃H₁₆Cl₂N₂O₂S

InChI: InChI=1/C13H15ClN2O2S.ClH/c14-12-6-1-5-11-10(12)4-2-7-13(11)19(17,18)16-9-3-8-15;/h1-2,4-7,16H,3,8-9,15H2;1H

SMILES: c1cc2c(cccc2S(=O)(=O)NCCCN)c(c1)Cl.Cl

N-(3-Aminopropyl)-5-chloronaphthalene-1-sulphonamide hydrochloride

CAS: 78957-86-5

N-(3-Aminopropyl)-5-chloronaphthalene-1-sulphonamide hydrochloride

Purity: ≥95%

Molecular weight: 335.25g/mol

Ref: 54-OR2825T

N-(3-Aminopropyl)-5-chloro-1-naphthalenesulfonamide Hydrochloride

Controlled Product

CAS: 78957-86-5

Applications N-(3-Aminopropyl)-5-chloro-1-naphthalenesulfonamide Hydrochloride (cas# 78957-86-5) is a compound useful in organic synthesis.
References Hidaka, H., et al.: Proc. Nat. Acad. Sci. USA, 78, 4354 (1981)

Formula: C₁₃H₁₇Cl₂N₂O₂S

Color and Shape: Neat

Molecular weight: 335.25

Ref: TR-A628250