CymitQuimica logo

CAS 78961-43-0

:

(2Z)-2-(4-nitrobenzylidene)-1-azabicyclo[2.2.2]octan-3-one

Description:
The chemical substance known as (2Z)-2-(4-nitrobenzylidene)-1-azabicyclo[2.2.2]octan-3-one, with the CAS number 78961-43-0, is a bicyclic compound characterized by its unique structural features. It contains a bicyclo[2.2.2]octane framework, which is a saturated system with three fused rings, contributing to its rigidity and potential for specific interactions. The presence of a 4-nitrobenzylidene group introduces an electron-withdrawing nitro group, which can influence the compound's reactivity and polarity. The azabicyclic structure indicates the presence of a nitrogen atom within the bicyclic system, which can affect the compound's basicity and potential for forming hydrogen bonds. Additionally, the ketone functional group at the 3-position adds to the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic attacks. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility and stability, would depend on the surrounding conditions and solvent interactions.
Formula:C14H14N2O3
InChI:InChI=1/C14H14N2O3/c17-14-11-5-7-15(8-6-11)13(14)9-10-1-3-12(4-2-10)16(18)19/h1-4,9,11H,5-8H2/b13-9-
Synonyms:
  • 2-(4-Nitro-benzylidene)-1-aza-bicyclo[2.2.2]octan-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.