CAS 78967-81-4

2-Bromo-1-(2,4-dichlorophenyl)-1-butanone

Description:

2-Bromo-1-(2,4-dichlorophenyl)-1-butanone is an organic compound characterized by its bromine and dichlorophenyl substituents. It features a butanone backbone, which is a four-carbon chain with a ketone functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The dichlorophenyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals or agrochemicals, where halogenated compounds often exhibit enhanced properties. Safety considerations are essential when handling this substance, as halogenated organic compounds can pose health risks and environmental concerns. Proper storage and disposal methods should be followed to mitigate any hazards associated with its use.

Formula: C₁₀H₉BrCl₂O

InChI: InChI=1S/C10H9BrCl2O/c1-2-8(11)10(14)7-4-3-6(12)5-9(7)13/h3-5,8H,2H2,1H3

InChI key: InChIKey=YEPIPJCUGIAQRW-UHFFFAOYSA-N

SMILES: C(C(CC)Br)(=O)C1=C(Cl)C=C(Cl)C=C1

Synonyms:

• 2-Bromo-1-(2,4-dichlorophenyl)-1-butanone
• 1-Butanone, 2-bromo-1-(2,4-dichlorophenyl)-