CAS 78971-81-0
:7-(Ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane
Description:
7-(Ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane is a fluorinated organic compound characterized by its unique structure, which includes a long carbon chain with multiple fluorine substituents and an ethenyloxy functional group. The presence of fluorine atoms imparts significant chemical stability and hydrophobic properties, making it resistant to degradation and highly non-polar. This compound is likely to exhibit low surface tension and high thermal stability, which are typical of perfluorinated compounds. Its ethenyloxy group suggests potential reactivity, particularly in polymerization or coupling reactions, which could be exploited in various applications, including specialty coatings, surfactants, or as intermediates in organic synthesis. Additionally, due to the environmental concerns associated with fluorinated compounds, its use may be subject to regulatory scrutiny. Overall, the unique combination of fluorinated characteristics and functional groups makes this compound of interest in both industrial and research contexts.
Formula:C9H6F12O
InChI:InChI=1S/C9H6F12O/c1-2-22-3-5(12,13)7(16,17)9(20,21)8(18,19)6(14,15)4(10)11/h2,4H,1,3H2
InChI key:InChIKey=PSLCNUISXILWOY-UHFFFAOYSA-N
SMILES:C(C(C(C(F)F)(F)F)(F)F)(C(C(COC=C)(F)F)(F)F)(F)F
Synonyms:- 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl Ethenyl Ether
- 7-(Ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane
- Heptane, 7-(ethenyloxy)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-
- 1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluoro-7-(vinyloxy)heptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H,1H,7H-Perfluoroheptyl vinyl ether
CAS:1H,1H,7H-Perfluoroheptyl vinyl ether
Molecular weight:358.12418g/mol

