CAS 78977-89-6

[2-(4-methylphenyl)-5-oxocyclopent-1-en-1-yl]acetate

Description:

[2-(4-methylphenyl)-5-oxocyclopent-1-en-1-yl]acetate, with the CAS number 78977-89-6, is an organic compound characterized by its unique structural features. It contains a cyclopentene ring with a ketone functional group and an acetate moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-methylphenyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. This compound may exhibit interesting chemical properties, such as the ability to participate in various reactions, including nucleophilic substitutions and cycloadditions, due to the presence of both electron-rich and electron-deficient sites. Its structural complexity suggests potential utility in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature, solvent, and the presence of catalysts. Overall, [2-(4-methylphenyl)-5-oxocyclopent-1-en-1-yl]acetate represents a versatile building block in organic chemistry.

Formula: C₁₄H₁₃O₃

InChI: InChI=1/C14H14O3/c1-9-2-4-10(5-3-9)11-6-7-13(15)12(11)8-14(16)17/h2-5H,6-8H2,1H3,(H,16,17)/p-1

SMILES: Cc1ccc(cc1)C1=C(CC(=O)[O-])C(=O)CC1

2-(5-Oxo-2-(p-tolyl)cyclopent-1-en-1-yl)acetic acid

CAS: 78977-89-6

Formula: C₁₄H₁₄O₃

Molecular weight: 230.2592

Ref: IN-DA0054I6