CAS 78979-64-3

4-Thiazolecarboxylic acid, 2-(4-nitrophenyl)-, ethyl ester

Description:

4-Thiazolecarboxylic acid, 2-(4-nitrophenyl)-, ethyl ester is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of the 4-nitrophenyl group enhances its electronic properties, making it potentially useful in various chemical applications, including as a building block in organic synthesis and pharmaceuticals. The compound is likely to exhibit moderate to high polarity due to the carboxylic acid and nitro groups, influencing its solubility in polar solvents. Additionally, the thiazole ring can participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. Safety and handling precautions should be observed, as compounds with nitro groups can be sensitive and may pose health risks. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and material science.

Formula: C₁₂H₁₀N₂O₄S

InChI: InChI=1S/C12H10N2O4S/c1-2-18-12(15)10-7-19-11(13-10)8-3-5-9(6-4-8)14(16)17/h3-7H,2H2,1H3

InChI key: InChIKey=XQBNPFPSRBLFHV-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N=C(SC1)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• 2-(4-Nitro-phenyl)-thiazole-4-carboxylic acid ethyl ester
• 4-Thiazolecarboxylic acid, 2-(4-nitrophenyl)-, ethyl ester
• Ethyl 2-(4-nitrophenyl)thiazole-4-carboxylate
• Ethyl2-(4-nitrophenyl)thiazole-4-carboxylate

2-(4-Nitro-phenyl)-thiazole-4-carboxylic acid ethyl ester

CAS: 78979-64-3

Formula: C₁₂H₁₀N₂O₄S

Molecular weight: 278.2838

Ref: IN-DA005CTM