CymitQuimica logo

CAS 78982-94-2

:

1-(4-aminophenyl)-2-(dimethylamino)ethanol

Description:
1-(4-Aminophenyl)-2-(dimethylamino)ethanol, also known by its CAS number 78982-94-2, is an organic compound characterized by the presence of an amino group and a dimethylamino group attached to a phenyl ring. This compound typically appears as a solid or viscous liquid and is soluble in water due to the presence of hydroxyl and amino functional groups, which can engage in hydrogen bonding. Its molecular structure suggests it may exhibit basic properties, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution. The compound is of interest in medicinal chemistry and may have applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system. Additionally, its ability to interact with biological systems could be explored for therapeutic uses. Safety data should be consulted for handling and exposure guidelines, as compounds with amine functionalities can sometimes pose health risks.
Formula:C10H16N2O
InChI:InChI=1/C10H16N2O/c1-12(2)7-10(13)8-3-5-9(11)6-4-8/h3-6,10,13H,7,11H2,1-2H3
Synonyms:
  • 1-(4-Aminophenyl)-2-(dimethylamino)ethanol
  • Benzenemethanol, 4-amino-alpha-[(dimethylamino)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.