CAS 78985-13-4

2,3,5,6-Tetramethylbenzyl alcohol

Description:

2,3,5,6-Tetramethylbenzyl alcohol is an organic compound characterized by its structure, which features a benzyl alcohol moiety with four methyl groups attached to the benzene ring at the 2, 3, 5, and 6 positions. This arrangement contributes to its unique physical and chemical properties. The compound is typically a colorless to pale yellow liquid with a pleasant aromatic odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic methyl groups. The presence of the hydroxyl (-OH) group in the benzyl alcohol structure imparts some polar characteristics, allowing for hydrogen bonding. This compound is often used in the synthesis of various organic compounds and may serve as a fragrance or flavoring agent in certain applications. Additionally, its structure can influence its reactivity, making it a potential candidate for further chemical modifications in synthetic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₆O

InChI: InChI=1/C11H16O/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5,12H,6H2,1-4H3

SMILES: Cc1cc(C)c(C)c(CO)c1C

Synonyms:

• (2,3,5,6-Tetramethylphenyl)Methanol

2,3,5,6-Tetramethylbenzyl alcohol

CAS: 78985-13-4

Formula: C₁₁H₁₆O

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.2441

Ref: IN-DA003FF1

2,3,5,6-Tetramethylbenzylalcohol

CAS: 78985-13-4

2,3,5,6-Tetramethylbenzylalcohol

Purity: 95%

Molecular weight: 164.25g/mol

Ref: 54-OR1046703

2,3,5,6-Tetramethylbenzyl alcohol

CAS: 78985-13-4

2,3,5,6-Tetramethylbenzyl alcohol is a clear liquid with a faint odor and an oily feel. It is soluble in alcohols, ethers, and chloroform. 2,3,5,6-Tetramethylbenzyl alcohol has the ability to form hydrogen peroxide when exposed to air or light. The compound can be used as a starting material for the production of sulfones and sulfoxides. 2,3,5,6-Tetramethylbenzyl alcohol is stable at room temperature but decomposes at high temperatures.

Formula: C₁₁H₁₆O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 164.24 g/mol

Ref: 3D-FT172320