CymitQuimica logo

CAS 78987-46-9

:

1-[4-(morpholin-4-yl)phenyl]propan-1-one

Description:
1-[4-(Morpholin-4-yl)phenyl]propan-1-one, with the CAS number 78987-46-9, is an organic compound characterized by its structure, which includes a propanone moiety linked to a phenyl group that is further substituted with a morpholine ring. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the morpholine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as morpholine derivatives are known for their biological activity. Additionally, this compound may exhibit moderate to high stability under standard conditions, but like many organic compounds, it should be handled with care to avoid exposure to heat, light, or reactive agents that could lead to degradation or unwanted reactions.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c1-2-13(15)11-3-5-12(6-4-11)14-7-9-16-10-8-14/h3-6H,2,7-10H2,1H3
SMILES:CCC(=O)c1ccc(cc1)N1CCOCC1
Synonyms:
  • 1-Propanone, 1-[4-(4-Morpholinyl)Phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.