CAS 78987-56-1

1-[4-(propan-2-yl)phenyl]-1H-pyrrole-2,5-dione

Description:

1-[4-(Propan-2-yl)phenyl]-1H-pyrrole-2,5-dione, with the CAS number 78987-56-1, is an organic compound characterized by its unique structure that includes a pyrrole ring substituted with a phenyl group and an isopropyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential stability and reactivity due to the presence of the pyrrole moiety. The isopropyl substitution can influence its solubility and polarity, making it more lipophilic. The presence of the dione functional groups suggests that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Additionally, compounds of this nature may display interesting biological activities, making them of interest in medicinal chemistry and material science. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in research related to dyes, pharmaceuticals, or as intermediates in organic synthesis.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1/C13H13NO2/c1-9(2)10-3-5-11(6-4-10)14-12(15)7-8-13(14)16/h3-9H,1-2H3

SMILES: CC(C)c1ccc(cc1)N1C(=O)C=CC1=O

Synonyms:

• 1-(4-Isopropylphenyl)-1H-pyrrole-2,5-dione
• 1-(4-isopropylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione
• 1H-pyrrole-2,5-dione, 1-[4-(1-methylethyl)phenyl]-